CymitQuimica logo

CAS 1227958-15-7

:

1-Bromo-2-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-3-nitrobenzene

Description:
1-Bromo-2-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-3-nitrobenzene is an organic compound characterized by its complex structure, which includes a bromine atom, a nitro group, and a silyl ether functional group. The presence of the bromine atom indicates that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The nitro group contributes to the compound's electron-withdrawing properties, which can influence its reactivity and stability. The silyl ether moiety enhances the compound's solubility in organic solvents and provides protection for hydroxyl groups during chemical reactions. Additionally, the bulky tert-butyl group contributes to steric hindrance, which can affect the compound's reactivity and interactions with other molecules. Overall, this compound is of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its unique functional groups and potential for further chemical modifications.
Formula:C14H22BrNO3Si
InChI:InChI=1S/C14H22BrNO3Si/c1-14(2,3)20(4,5)19-10-9-11-12(15)7-6-8-13(11)16(17)18/h6-8H,9-10H2,1-5H3
InChI key:InChIKey=DGEQRGHOYGSUFX-UHFFFAOYSA-N
SMILES:C(CO[Si](C(C)(C)C)(C)C)C1=C(N(=O)=O)C=CC=C1Br
Synonyms:
  • Benzene, 1-bromo-2-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-3-nitro-
  • 1-Bromo-2-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-3-nitrobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.