CymitQuimica logo

CAS 1227958-54-4

:

Methyl 2-chloro-4-(4-morpholinyl)pyrido[2,3-d]pyrimidine-7-carboxylate

Description:
Methyl 2-chloro-4-(4-morpholinyl)pyrido[2,3-d]pyrimidine-7-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyridine and pyrimidine moiety. This compound features a chloro substituent and a morpholine group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the carboxylate group suggests it may participate in various chemical reactions, including esterification and nucleophilic substitution. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's unique arrangement of functional groups may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. As with many synthetic organic compounds, safety and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C13H13ClN4O3
InChI:InChI=1S/C13H13ClN4O3/c1-20-12(19)9-3-2-8-10(15-9)16-13(14)17-11(8)18-4-6-21-7-5-18/h2-3H,4-7H2,1H3
InChI key:InChIKey=YUFPNTVTPKNZLN-UHFFFAOYSA-N
SMILES:ClC=1N=C(C2=C(N=C(C(OC)=O)C=C2)N1)N3CCOCC3
Synonyms:
  • Methyl 2-chloro-4-(4-morpholinyl)pyrido[2,3-d]pyrimidine-7-carboxylate
  • Pyrido[2,3-d]pyrimidine-7-carboxylic acid, 2-chloro-4-(4-morpholinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.