CAS 122799-38-6
:2'-fluorothymidine
Description:
2'-Fluorothymidine, also known as 2'-F-thymidine, is a nucleoside analog of thymidine, characterized by the substitution of a fluorine atom at the 2' position of the ribose sugar. This modification enhances its stability and alters its biological activity, making it a subject of interest in antiviral and anticancer research. The compound is typically a white to off-white crystalline solid, soluble in water and organic solvents, which facilitates its use in various biochemical applications. Its mechanism of action involves incorporation into DNA during replication, leading to chain termination and inhibition of viral replication or tumor cell proliferation. 2'-Fluorothymidine has been studied for its potential therapeutic effects against certain viral infections and as a chemotherapeutic agent in cancer treatment. Additionally, it can be used as a tracer in positron emission tomography (PET) imaging due to its ability to mimic natural nucleosides. Overall, 2'-fluorothymidine represents a significant compound in medicinal chemistry with promising applications in both virology and oncology.
Formula:C10H13FN2O5
InChI:InChI=1/C10H13FN2O5/c1-4-2-13(10(17)12-8(4)16)9-6(11)7(15)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6-,7-,9-/m1/s1
SMILES:Cc1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)F)c(=O)nc1O
Synonyms:- Thymidine, 2'-Fluoro-
- 2'-Deoxy-2'-Fluorothymidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Uridine, 2'-deoxy-2'-fluoro-5-methyl-
CAS:Formula:C10H13FN2O5Purity:%Color and Shape:SolidMolecular weight:260.21902'-Deoxy-2'-fluoro-5-methyluridine
CAS:2'-Deoxy-2'-fluoro-5-methyluridine is a nucleoside analog that is a modified version of uridine, where the sugar (deoxyribose) has a fluoro modification at the 2' position and a methyl group is attached at the 5' position of the uracil base.
Formula:C10H13FN2O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:260.22 g/mol2'-Fluorothymidine
CAS:2'-Fluorothymidine is a selective substrate for TK2, related to thymidine and methyluridine.Formula:C10H13FN2O5Purity:99.98%Color and Shape:SolidMolecular weight:260.22Ref: TM-T19101
1mg50.00€5mg105.00€10mg161.00€25mg276.00€50mg416.00€100mg625.00€200mg837.00€1mL*10mM (DMSO)101.00€



