CAS 122799-38-6

2'-fluorothymidine

Description:

2'-Fluorothymidine, also known as 2'-F-thymidine, is a nucleoside analog of thymidine, characterized by the substitution of a fluorine atom at the 2' position of the ribose sugar. This modification enhances its stability and alters its biological activity, making it a subject of interest in antiviral and anticancer research. The compound is typically a white to off-white crystalline solid, soluble in water and organic solvents, which facilitates its use in various biochemical applications. Its mechanism of action involves incorporation into DNA during replication, leading to chain termination and inhibition of viral replication or tumor cell proliferation. 2'-Fluorothymidine has been studied for its potential therapeutic effects against certain viral infections and as a chemotherapeutic agent in cancer treatment. Additionally, it can be used as a tracer in positron emission tomography (PET) imaging due to its ability to mimic natural nucleosides. Overall, 2'-fluorothymidine represents a significant compound in medicinal chemistry with promising applications in both virology and oncology.

Formula: C₁₀H₁₃FN₂O₅

InChI: InChI=1/C10H13FN2O5/c1-4-2-13(10(17)12-8(4)16)9-6(11)7(15)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6-,7-,9-/m1/s1

SMILES: Cc1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)F)c(=O)nc1O

Synonyms:

• Thymidine, 2'-Fluoro-
• 2'-Deoxy-2'-Fluorothymidine

Uridine, 2'-deoxy-2'-fluoro-5-methyl-

CAS: 122799-38-6

Formula: C₁₀H₁₃FN₂O₅

Purity: %

Color and Shape: Solid

Molecular weight: 260.2190

Ref: IN-DA000JI7

2'-Fluorothymidine

CAS: 122799-38-6

2'-Fluorothymidine

Purity: ≥98%

Molecular weight: 260.22g/mol

Ref: 54-BUP11607

2'-Deoxy-2'-fluoro-5-methyluridine

CAS: 122799-38-6

2'-Deoxy-2'-fluoro-5-methyluridine is a nucleoside analog that is a modified version of uridine, where the sugar (deoxyribose) has a fluoro modification at the 2' position and a methyl group is attached at the 5' position of the uracil base.

Formula: C₁₀H₁₃FN₂O₅

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 260.22 g/mol

Ref: 3D-ND03465

2'-Fluorothymidine

CAS: 122799-38-6

2'-Fluorothymidine is a selective substrate for TK2, related to thymidine and methyluridine.

Formula: C₁₀H₁₃FN₂O₅

Purity: 99.67%

Color and Shape: Solid

Molecular weight: 260.22

Ref: TM-T19101