CymitQuimica logo

CAS 1228070-74-3

:

Butanedioic acid, compd. with N-[3-[[3-(dimethylamino)propyl]amino]propyl]-4-pyridinecarboxamide (2:1)

Description:
Butanedioic acid, compd. with N-[3-[[3-(dimethylamino)propyl]amino]propyl]-4-pyridinecarboxamide (2:1), also known by its CAS number 1228070-74-3, is a chemical compound that features a complex structure combining a dicarboxylic acid and a pyridine-based amide. This compound typically exhibits characteristics associated with both its acidic and amide components, such as solubility in polar solvents and potential for hydrogen bonding due to the presence of carboxylic acid and amine functional groups. The dimethylamino group contributes to its basicity and may influence its reactivity and interaction with biological systems. The presence of the pyridine ring can enhance the compound's stability and may also impart specific electronic properties. This compound may be of interest in pharmaceutical applications, particularly in drug design, due to its potential to interact with biological targets. Overall, its unique combination of functional groups suggests a versatile profile for various chemical and biological applications.
Formula:C14H24N4O·2C4H6O4
InChI:InChI=1S/C14H24N4O.C4H6O4/c1-18(2)12-4-8-15-7-3-9-17-14(19)13-5-10-16-11-6-13;5-3(6)1-2-4(7)8/h5-6,10-11,15H,3-4,7-9,12H2,1-2H3,(H,17,19);1-2H2,(H,5,6)(H,7,8)
InChI key:InChIKey=FGKXUARQMFSXOE-UHFFFAOYSA-N
SMILES:C(NCCCNCCCN(C)C)(=O)C=1C=CN=CC1.C(CC(O)=O)C(O)=O
Synonyms:
  • Butanedioic acid, compd. with N-[3-[[3-(dimethylamino)propyl]amino]propyl]-4-pyridinecarboxamide (2:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.