CymitQuimica logo

CAS 1228070-76-5

:

1-Pyrrolidinebutanoic acid, β-oxo-, ethyl ester, hydrochloride (1:1)

Description:
1-Pyrrolidinebutanoic acid, β-oxo-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure and a butanoic acid moiety with a β-oxo group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The ethyl ester component contributes to its lipophilicity, making it potentially useful in various pharmaceutical applications. The presence of the β-oxo group suggests that it may participate in various chemical reactions, including condensation and acylation, which can be relevant in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would require further investigation. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the compound may pose risks typical of organic acids and esters.
Formula:C10H17NO3·ClH
InChI:InChI=1S/C10H17NO3.ClH/c1-2-14-10(13)7-9(12)8-11-5-3-4-6-11;/h2-8H2,1H3;1H
InChI key:InChIKey=HUANFEIONQAATO-UHFFFAOYSA-N
SMILES:C(C(CC(OCC)=O)=O)N1CCCC1.Cl
Synonyms:
  • 1-Pyrrolidinebutanoic acid, β-oxo-, ethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.