
CAS 1228070-84-5
:Pyrrolidine, 3-(2,4-dimethylphenoxy)-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-(2,4-dimethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 2,4-dimethylphenoxy group indicates that it has a phenolic structure with two methyl substituents on the aromatic ring, contributing to its hydrophobic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its molecular structure suggests it could be involved in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Overall, this compound's unique structure and properties make it of interest in medicinal chemistry and related fields.
Formula:C12H17NO·ClH
InChI:InChI=1S/C12H17NO.ClH/c1-9-3-4-12(10(2)7-9)14-11-5-6-13-8-11;/h3-4,7,11,13H,5-6,8H2,1-2H3;1H
InChI key:InChIKey=QCDZCOGZJBFXHC-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=C(C)C=C1)C2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-(2,4-dimethylphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.