CAS 1228070-87-8

1,2-Benzisoxazole-3-methanamine, 4,5,6,7-tetrahydro-N-methyl-, hydrochloride (1:1)

Description:

1,2-Benzisoxazole-3-methanamine, 4,5,6,7-tetrahydro-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to an isoxazole moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated cyclic structure, and a methylated amine group, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. The hydrochloride salt enhances its solubility in water, making it more bioavailable for pharmaceutical applications. The compound may exhibit various biological activities, potentially including neuroactive properties, due to its structural similarity to other psychoactive substances. Its molecular interactions are influenced by the presence of the amine and isoxazole functionalities, which can participate in hydrogen bonding and other intermolecular interactions. As with many compounds in medicinal chemistry, understanding its pharmacokinetics, toxicity, and therapeutic potential would require further empirical studies and characterization.

Formula: C₉H₁₄N₂O·ClH

InChI: InChI=1S/C9H14N2O.ClH/c1-10-6-8-7-4-2-3-5-9(7)12-11-8;/h10H,2-6H2,1H3;1H

InChI key: InChIKey=XPCQADKBFJGPFV-UHFFFAOYSA-N

SMILES: C(NC)C=1C2=C(ON1)CCCC2.Cl

Synonyms:

• 1,2-Benzisoxazole-3-methanamine, 4,5,6,7-tetrahydro-N-methyl-, hydrochloride (1:1)