CAS 1228070-88-9

3-Furanmethanamine, 5-(1,1-dimethylethyl)-, hydrochloride (1:1)

Description:

3-Furanmethanamine, 5-(1,1-dimethylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features an amine functional group, indicating its potential basicity and ability to form salts, as evidenced by its hydrochloride form. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its hydrophobic characteristics, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Its molecular interactions, stability, and potential applications would be influenced by its structural features, including the furan moiety and the amine group. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₉H₁₅NO·ClH

InChI: InChI=1S/C9H15NO.ClH/c1-9(2,3)8-4-7(5-10)6-11-8;/h4,6H,5,10H2,1-3H3;1H

InChI key: InChIKey=PSLCDLVMCHEZMR-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=CC(CN)=CO1.Cl

Synonyms:

• 3-Furanmethanamine, 5-(1,1-dimethylethyl)-, hydrochloride (1:1)
• [(5-tert-Butyl-3-furyl)methyl]amine hydrochloride
• 1-(5-tert-butylfuran-3-yl)methanamine Hydrochloride