CymitQuimica logo

CAS 1228112-81-9

:

6-Cycloheptyl-3-pyridinecarboxylic acid

Description:
6-Cycloheptyl-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring and a cycloheptyl substituent. The presence of the carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. This compound features a bicyclic structure, which contributes to its unique steric and electronic properties. The cycloheptyl group provides a hydrophobic character, while the pyridine ring introduces basicity due to the nitrogen atom, which can participate in hydrogen bonding and coordination with metal ions. The compound's solubility is influenced by the balance between its hydrophobic cycloheptyl portion and the polar carboxylic acid group. Additionally, 6-Cycloheptyl-3-pyridinecarboxylic acid may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific reactivity and interactions would depend on the surrounding environment and potential substituents. Overall, this compound exemplifies the complexity and diversity of organic molecules in terms of structure and function.
Formula:C13H17NO2
InChI:InChI=1S/C13H17NO2/c15-13(16)11-7-8-12(14-9-11)10-5-3-1-2-4-6-10/h7-10H,1-6H2,(H,15,16)
InChI key:InChIKey=KEKQOZTYVDPSPU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(N=C1)C2CCCCCC2
Synonyms:
  • 6-Cycloheptyl-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 6-cycloheptyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.