
CAS 1228180-84-4
:B-[4-(2-Hydroxyethoxy)-3-methoxyphenyl]boronic acid
Description:
B-[4-(2-Hydroxyethoxy)-3-methoxyphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a methoxy group and a hydroxyethoxy group, contributing to its solubility and reactivity. The hydroxyethoxy group enhances its potential for hydrogen bonding, while the methoxy group can influence its electronic properties and steric hindrance. Boronic acids are often utilized in organic synthesis, particularly in Suzuki coupling reactions, which are valuable for forming carbon-carbon bonds. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as solubility in polar solvents and reactivity with various substrates, make it a versatile building block in both synthetic and pharmaceutical chemistry. Overall, B-[4-(2-Hydroxyethoxy)-3-methoxyphenyl]boronic acid is a significant compound with diverse applications in research and industry.
Formula:C9H13BO5
InChI:InChI=1S/C9H13BO5/c1-14-9-6-7(10(12)13)2-3-8(9)15-5-4-11/h2-3,6,11-13H,4-5H2,1H3
InChI key:InChIKey=KABGEVCSKHNYQK-UHFFFAOYSA-N
SMILES:O(CCO)C1=C(OC)C=C(B(O)O)C=C1
Synonyms:- [4-(2-Hydroxyethoxy)-3-methoxyphenyl]boronic acid
- B-[4-(2-Hydroxyethoxy)-3-methoxyphenyl]boronic acid
- Boronic acid, B-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.