
CAS 1228181-37-0
:B-[4-(2-Pyridinyloxy)phenyl]boronic acid
Description:
B-[4-(2-Pyridinyloxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a pyridinyloxy moiety. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar organic solvents. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridinyloxy group can enhance its reactivity and selectivity in coupling reactions, particularly in the context of Suzuki-Miyaura cross-coupling reactions. Additionally, boronic acids are often utilized in the development of sensors and in the field of drug discovery due to their ability to interact with biological molecules. Safety data sheets should be consulted for handling and storage guidelines, as boronic acids can be sensitive to moisture and may require specific conditions to maintain stability.
Formula:C11H10BNO3
InChI:InChI=1S/C11H10BNO3/c14-12(15)9-4-6-10(7-5-9)16-11-3-1-2-8-13-11/h1-8,14-15H
InChI key:InChIKey=RMWBKINYUIMITI-UHFFFAOYSA-N
SMILES:O(C1=CC=C(B(O)O)C=C1)C2=CC=CC=N2
Synonyms:- B-[4-(2-Pyridinyloxy)phenyl]boronic acid
- [4-(Pyridin-2-yloxy)phenyl]boronic acid
- Boronic acid, B-[4-(2-pyridinyloxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
