CAS 1228182-34-0

((4-TrifluoroMethyl)phenyl)di-tert-butylphosphine

Description:

((4-TrifluoroMethyl)phenyl)di-tert-butylphosphine is an organophosphorus compound characterized by the presence of a phosphine functional group attached to a phenyl ring that has a trifluoromethyl substituent. This compound typically exhibits properties associated with phosphines, such as being a strong nucleophile and a potential ligand in coordination chemistry. The presence of the trifluoromethyl group enhances the electron-withdrawing characteristics of the phenyl ring, which can influence the reactivity and stability of the phosphine. The tert-butyl groups contribute to steric hindrance, affecting the compound's ability to coordinate with metals and participate in catalytic processes. Additionally, the compound may exhibit unique solubility characteristics due to the bulky tert-butyl groups and the electronegative fluorine atoms. Its applications may include use in organic synthesis, catalysis, and as a ligand in metal complexes. Safety data should be consulted, as organophosphorus compounds can vary in toxicity and handling requirements.

Formula: C₁₅H₂₂F₃P

InChI: InChI=1S/C15H22F3P/c1-13(2,3)19(14(4,5)6)12-9-7-11(8-10-12)15(16,17)18/h7-10H,1-6H3

SMILES: CC(C)(C)P(c1ccc(cc1)C(F)(F)F)C(C)(C)C

Synonyms:

• Di-tert-butyl(4-(trifluoromethyl)phenyl)phosphine

Phosphine, bis(1,1-dimethylethyl)[4-(trifluoromethyl)phenyl]-

CAS: 1228182-34-0

Formula: C₁₅H₂₂F₃P

Purity: 90%

Molecular weight: 290.3042

Ref: IN-DA000JJJ

Di-tert-butyl(4-(trifluoromethyl)phenyl)phosphine

CAS: 1228182-34-0

Di-tert-butyl(4-(trifluoromethyl)phenyl)phosphine

Purity: 90%

Molecular weight: 290.31g/mol

Ref: 54-PC1006168