CAS 1228267-66-0

6-(4-Bromophenyl)-2-naphthalenecarbonitrile

Description:

6-(4-Bromophenyl)-2-naphthalenecarbonitrile is an organic compound characterized by its complex structure, which includes a naphthalene ring system substituted with a bromophenyl group and a cyano functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points. The presence of the bromine atom introduces notable electronegative characteristics, which can influence the compound's reactivity and solubility in various solvents. The cyano group (-C≡N) contributes to the compound's polarity and can participate in various chemical reactions, including nucleophilic additions. Additionally, this compound may exhibit fluorescence properties, making it of interest in materials science and organic electronics. Its synthesis often involves multi-step reactions, and it may be utilized in research related to pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₁₇H₁₀BrN

InChI: InChI=1S/C17H10BrN/c18-17-7-5-13(6-8-17)15-4-3-14-9-12(11-19)1-2-16(14)10-15/h1-10H

InChI key: InChIKey=MQHXIFIRTZAXMX-UHFFFAOYSA-N

SMILES: C(#N)C1=CC2=C(C=C(C=C2)C3=CC=C(Br)C=C3)C=C1

Synonyms:

• 2-Naphthalenecarbonitrile, 6-(4-bromophenyl)-
• 6-(4-Bromophenyl)-2-naphthalenecarbonitrile