CAS 122828-62-0
:2-Azulenepropanol
Description:
2-Azulenepropanol, with the CAS number 122828-62-0, is a chemical compound characterized by its unique azulene structure, which imparts distinct properties. Azulene is known for its deep blue color and aromatic nature, contributing to the compound's stability and reactivity. The presence of a propanol group indicates that this compound has hydroxyl (-OH) functionality, which can influence its solubility and reactivity in various chemical environments. Typically, compounds like 2-Azulenepropanol may exhibit moderate polarity due to the hydroxyl group, making them soluble in polar solvents while retaining some hydrophobic characteristics from the azulene moiety. This compound may also participate in hydrogen bonding, affecting its boiling and melting points. Additionally, the unique structure of azulene can lead to interesting electronic properties, making it a subject of interest in organic chemistry and materials science. Overall, 2-Azulenepropanol combines the intriguing features of both azulene and alcohol functionalities, potentially leading to diverse applications in chemical synthesis and as a building block in organic materials.
Formula:C13H14O
InChI:InChI=1S/C13H14O/c14-8-4-5-11-9-12-6-2-1-3-7-13(12)10-11/h1-3,6-7,9-10,14H,4-5,8H2
InChI key:InChIKey=YLRGSPJZACJCDI-UHFFFAOYSA-N
SMILES:C(CCO)C1=CC=2C(=C1)C=CC=CC2
Synonyms:- 2-Azulenepropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
