CAS 122830-14-2
:Deriglidole
Description:
Deriglidole, identified by its CAS number 122830-14-2, is a chemical compound that belongs to the class of substances known as synthetic cannabinoids. These compounds are designed to mimic the effects of naturally occurring cannabinoids found in cannabis. Deriglidole exhibits a high affinity for cannabinoid receptors in the brain, particularly CB1 and CB2 receptors, which are involved in various physiological processes, including pain sensation, mood regulation, and appetite control. The substance is typically characterized by its complex molecular structure, which contributes to its pharmacological properties. As with many synthetic cannabinoids, the safety profile and long-term effects of Deriglidole are not fully understood, and it may pose risks of adverse effects, including psychoactive effects and potential toxicity. Due to its synthetic nature, it may also be subject to legal regulations in various jurisdictions. Research into its pharmacodynamics and therapeutic potential is ongoing, as scientists seek to better understand its implications for medical use and public health.
Formula:C16H21N3
InChI:InChI=1/C16H21N3/c1-2-7-16(15-17-8-9-18-15)11-13-5-3-4-12-6-10-19(16)14(12)13/h3-5H,2,6-11H2,1H3,(H,17,18)
SMILES:CCCC1(Cc2cccc3CCN1c23)C1=NCCN1
Synonyms:- Deriglidole [INN]
- (+)-1,2,4,5-Tetrahydro-2-(2-imidazolin-2-yl)-2-propylpyrrolo(3,2,1-hi)indole
- Unii-68Ep8R4Pmv
- 2-(4,5-dihydro-1H-imidazol-2-yl)-2-propyl-1,2,4,5-tetrahydropyrrolo[3,2,1-hi]indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Deriglidole
CAS:Deriglidole is a synthetic compound, which is an organic molecule developed through chemical synthesis. Its source is a lab-engineered process, designed to provide consistency and precision in its molecular structure. This compound functions by inhibiting specific enzymes involved in critical metabolic pathways, thereby altering the biochemical reactions within cellular systems.Formula:C16H21N3Purity:Min. 95%Molecular weight:255.36 g/molDeriglidole
CAS:Deriglidole (SL 86-0715), an alpha2 receptor inhibitor, blocks colistin/Idazoxan but not prazosin/α2-adrenergic receptors.Formula:C16H21N3Purity:98.12% - 99.03%Color and Shape:SolidMolecular weight:255.36


