CAS 122835-14-7
:5-BROMO-2-(PROP-2-YNYLOXY)BENZALDEHYDE
Description:
5-Bromo-2-(prop-2-ynyloxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an aldehyde functional group. The presence of the prop-2-ynyloxy group indicates that it contains a propyne moiety linked via an ether bond to the benzaldehyde framework. This compound typically exhibits a yellow to brown color and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic aromatic and alkyne components. Its reactivity is influenced by the electron-withdrawing nature of the aldehyde and bromine groups, making it a potential candidate for various chemical reactions, including nucleophilic additions and coupling reactions. Additionally, the compound may be of interest in synthetic organic chemistry and materials science, particularly in the development of functionalized polymers or as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated organic substances.
Formula:C10H7BrO2
InChI:InChI=1/C10H7BrO2/c1-2-5-13-10-4-3-9(11)6-8(10)7-12/h1,3-4,6-7H,5H2
SMILES:C#CCOc1ccc(cc1C=O)Br
Synonyms:- Benzaldehyde, 5-Bromo-2-(2-Propyn-1-Yloxy)-
- 5-Bromo-2-(Prop-2-Yn-1-Yloxy)Benzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Bromo-2-(prop-2-yn-1-yloxy)benzaldehyde
CAS:5-Bromo-2-(prop-2-yn-1-yloxy)benzaldehyde is a cytotoxic agent that is used as an anticancer drug. It has been shown to have significant cytotoxic activity against the breast adenocarcinoma cell line, MDA-MB231. The cytotoxicity of 5-bromo-2-(prop-2-yn-1-yloxy)benzaldehyde is due to its ability to react with nucleophiles, such as DNA and proteins, in cells. This molecule also has antibacterial and antifungal activities. 5-Bromo-2-(prop-2-yn-1 -yloxy)benzaldehyde can be used for the treatment of bacterial and fungal infections, such as those caused by Aspergillus niger.Formula:C10H7BrO2Purity:Min. 95%Molecular weight:239.06 g/mol

