CAS 122842-47-1
:Hydrin 1
Description:
Hydrin 1, identified by its CAS number 122842-47-1, is a chemical compound that belongs to the class of polyether polyols. It is primarily used in the production of polyurethane foams and elastomers, contributing to their flexibility and durability. Hydrin 1 is characterized by its low viscosity, which facilitates easy processing and incorporation into various formulations. The compound exhibits good thermal stability and resistance to hydrolysis, making it suitable for applications in diverse environments. Additionally, Hydrin 1 is known for its compatibility with a range of other materials, enhancing the performance of the final products. Safety data sheets typically indicate that it should be handled with care, as with many chemical substances, to minimize exposure risks. Overall, Hydrin 1 plays a significant role in the development of high-performance materials across multiple industries, including automotive, construction, and consumer goods.
Formula:C57H93N21O16S2
InChI:InChI=1/C57H93N21O16S2/c1-3-29(2)45-53(91)72-35(17-18-41(60)80)49(87)75-38(24-42(61)81)50(88)76-39(28-96-95-27-32(59)46(84)74-37(51(89)77-45)23-30-13-15-31(79)16-14-30)54(92)78-22-8-12-40(78)52(90)71-33(10-6-20-66-56(62)63)47(85)69-25-43(82)68-26-44(83)70-34(9-4-5-19-58)48(86)73-36(55(93)94)11-7-21-67-57(64)65/h13-16,29,32-40,45,79H,3-12,17-28,58-59H2,1-2H3,(H2,60,80)(H2,61,81)(H,68,82)(H,69,85)(H,70,83)(H,71,90)(H,72,91)(H,73,86)(H,74,84)(H,75,87)(H,76,88)(H,77,89)(H,93,94)(H4,62,63,66)(H4,64,65,67)/t29-,32-,33-,34-,35-,36-,37-,38-,39-,40-,45?/m0/s1
SMILES:CC[C@H](C)C1C(=N[C@@H](CCC(=N)O)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CSSC[C@@H](C(=N[C@@H](Cc2ccc(cc2)O)C(=N1)O)O)N)C(=O)N1CCC[C@H]1C(=N[C@@H](CCCNC(=N)N)C(=NCC(=NCC(=N[C@@H](CCCCN)C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)O)O)O)O)O)O)O
Synonyms:- Oxytocin, 8-L-arginine-9a-glycine-9b-L-lysine-9c-L-arginine-
- 1-{[(4R,7S,10S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-butan-2-yl]-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-N~5~-(diaminomethylidene)-L-ornithylglycylglycyl-L-lysyl-N~5~-(diaminomethylidene)-L-ornithine
- (Arg8)-Vasotocin-Gly-Lys-Arg
- H-Cys-Tyr-Ile-Gln-Asn-Cys-Pro-Arg-Gly-Gly-Lys-Arg-OH (Disulfide bond)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Oxytocin, 8-L-arginine-9a-glycine-9b-L-lysine-9c-L-arginine-
CAS:Formula:O3RuMolecular weight:155.1158Hydrin 1
CAS:Hydrin 1 is a fatty acid that is expressed in the apical membrane of bladder cells, which are the cells that line the urinary tract. It is also found in the blood vessels and heart. Hydrin 1 has been shown to have biological properties such as being taken up by water, interacting with other molecules, and forming reaction products. The ventral part of the cell membrane is where Hydrin 1 is mostly expressed, but it can also be found in other parts of the organism. Hydrin 1 binds to messenger RNA and has been used as a model system for studying protein-lipid interactions. The effective dose for Hydrin 1 is not known. This drug can be conjugated with bile salts to form an active metabolite called hydroxylinoleic acid (HOLA). HOLA binds to receptors on vascular smooth muscle cells and lowers blood pressure by decreasing peripheral resistance and vascular tone.Formula:C57H93N21O16S2Purity:Min. 95%Molecular weight:1,392.61 g/mol

