CymitQuimica logo

CAS 1228427-76-6

:

2-[(2-Hydroxyethyl)dithio]ethyl 2-bromo-2-methylpropanoate

Description:
2-[(2-Hydroxyethyl)dithio]ethyl 2-bromo-2-methylpropanoate is a chemical compound characterized by its unique structure, which includes a dithioether functional group and a bromoester moiety. This compound features a hydroxyethyl group that contributes to its solubility and reactivity. The presence of the bromine atom indicates potential for nucleophilic substitution reactions, making it useful in organic synthesis. The dithioether linkage provides additional reactivity and may enhance the compound's ability to participate in various chemical transformations, such as thiol-ene reactions. Its molecular structure suggests it may exhibit moderate polarity, influencing its interactions in biological systems or industrial applications. Additionally, the compound's specific functional groups may impart unique properties, such as potential antimicrobial or antioxidant activities, although empirical studies would be necessary to confirm such characteristics. Overall, this compound's distinctive features make it a subject of interest in both synthetic chemistry and potential applications in materials science or pharmaceuticals.
Formula:C8H15BrO3S2
InChI:InChI=1S/C8H15BrO3S2/c1-8(2,9)7(11)12-4-6-14-13-5-3-10/h10H,3-6H2,1-2H3
InChI key:InChIKey=XOYBOVVEAZCGEU-UHFFFAOYSA-N
SMILES:O(CCSSCCO)C(C(Br)(C)C)=O
Synonyms:
  • 2-2((2-Hydroxyethyl)disulfanyl)ethyl 2-bromo-2-methylpropanoate
  • Propanoic acid, 2-bromo-2-methyl-, 2-[(2-hydroxyethyl)dithio]ethyl ester
  • 2-[(2-Hydroxyethyl)dithio]ethyl 2-bromoisobutyrate
  • 2-[(2-Hydroxyethyl)dithio]ethyl 2-bromo-2-methylpropanoate
  • 2-[(2-Hydroxyethyl)disulfanyl]ethyl 2-bromo-2-methylpropanoate
Found 4 products.