CAS 1228450-23-4

4H-Azepin-4-one, hexahydro-5-methyl-, hydrochloride (1:1)

Description:

4H-Azepin-4-one, hexahydro-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclic structure, specifically a saturated seven-membered ring containing a nitrogen atom. This compound features a ketone functional group and is substituted with a methyl group, which influences its reactivity and physical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrochloride indicates that it can form stable ionic interactions, which may affect its bioavailability and pharmacokinetics. The compound's molecular structure suggests potential applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of biologically active molecules. Additionally, its unique structural features may confer specific biological activities, making it of interest for further research in drug development and related fields. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₁₃NO·ClH

InChI: InChI=1S/C7H13NO.ClH/c1-6-2-4-8-5-3-7(6)9;/h6,8H,2-5H2,1H3;1H

InChI key: InChIKey=HWEPWXKHORTTJJ-UHFFFAOYSA-N

SMILES: CC1C(=O)CCNCC1.Cl

Synonyms:

• 4H-Azepin-4-one, hexahydro-5-methyl-, hydrochloride (1:1)

5-Methylazepan-4-one hydrochloride

CAS: 1228450-23-4

Formula: C₇H₁₄ClNO

Purity: %

Color and Shape: Solid

Molecular weight: 163.6452

Ref: IN-DA00HH1D

5-Methylazepan-4-one hydrochloride

CAS: 1228450-23-4

5-Methylazepan-4-one hydrochloride

Purity: 95%

Molecular weight: 163.65g/mol

Ref: 54-OR1064090

5-METHYLAZEPAN-4-ONE HCL

CAS: 1228450-23-4

Formula: C₇H₁₄ClNO

Purity: 95.0%

Molecular weight: 163.65

Ref: 10-F469673