
CAS 1228548-02-4
:N-[3-[(1R)-1-Aminoethyl]phenyl]acetamide
Description:
N-[3-[(1R)-1-Aminoethyl]phenyl]acetamide, identified by its CAS number 1228548-02-4, is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical agent. This compound features a phenyl ring substituted with an aminoethyl group, suggesting it may exhibit biological activity due to the presence of the amino group that can participate in hydrogen bonding and interact with biological targets. The (1R)-1-aminoethyl moiety indicates a specific stereochemistry, which can influence the compound's pharmacodynamics and pharmacokinetics. Typically, compounds of this nature are investigated for their potential roles in medicinal chemistry, particularly in the development of drugs targeting various physiological pathways. The presence of both an acetamide and an amino group suggests potential solubility in polar solvents, which is often a desirable property for bioavailability. Overall, the structural features of N-[3-[(1R)-1-Aminoethyl]phenyl]acetamide indicate it may have significant implications in therapeutic applications, although specific biological activities would require further empirical investigation.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-7(11)9-4-3-5-10(6-9)12-8(2)13/h3-7H,11H2,1-2H3,(H,12,13)/t7-/m1/s1
InChI key:InChIKey=MKUVXAZZKXTGOK-SSDOTTSWSA-N
SMILES:N(C(C)=O)C1=CC([C@@H](C)N)=CC=C1
Synonyms:- Acetamide, N-[3-[(1R)-1-aminoethyl]phenyl]-
- N-[3-[(1R)-1-Aminoethyl]phenyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.