
CAS 1228549-96-9
:(2R)-2-[4-(Trifluoromethyl)phenyl]pyrrolidine
Description:
(2R)-2-[4-(Trifluoromethyl)phenyl]pyrrolidine is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing heterocycle. The compound features a trifluoromethyl group attached to a phenyl ring, contributing to its unique electronic properties and potential biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The (2R) designation indicates that the compound has a specific stereochemistry, which can significantly influence its pharmacological properties and interactions with biological targets. This compound may be explored for applications in drug development, particularly in the fields of neuropharmacology or as a building block in organic synthesis. Its molecular structure suggests potential interactions with various receptors or enzymes, making it a candidate for further research in therapeutic contexts. As with many fluorinated compounds, it may exhibit unique solubility and reactivity characteristics, which are important for its application in various chemical and pharmaceutical processes.
Formula:C11H12F3N
InChI:InChI=1S/C11H12F3N/c12-11(13,14)9-5-3-8(4-6-9)10-2-1-7-15-10/h3-6,10,15H,1-2,7H2/t10-/m1/s1
InChI key:InChIKey=GSOGADJIIMVREB-SNVBAGLBSA-N
SMILES:C(F)(F)(F)C1=CC=C(C=C1)[C@H]2CCCN2
Synonyms:- (2R)-2-[4-(Trifluoromethyl)phenyl]pyrrolidine
- Pyrrolidine, 2-[4-(trifluoromethyl)phenyl]-, (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.