CAS 122855-49-6: Panaxyne
Description:Panaxyne, identified by its CAS number 122855-49-6, is a chemical compound that belongs to the class of alkynes, characterized by the presence of a carbon-carbon triple bond. This compound is notable for its unique structural features, which may contribute to its potential applications in various fields, including medicinal chemistry and materials science. Panaxyne may exhibit properties such as hydrophobicity, depending on its molecular structure, and could interact with biological systems in specific ways, making it of interest for research into therapeutic agents. Additionally, its reactivity profile may allow for participation in various organic reactions, including coupling reactions and functionalization processes. As with many alkynes, safety considerations are essential when handling Panaxyne, as it may pose risks such as flammability or toxicity. Overall, while specific data on its physical and chemical properties may vary, Panaxyne represents a compound with potential utility in both academic and industrial applications.
Formula:C14H20O2
InChI:InChI=1S/C14H20O2/c1-3-5-7-8-10-12-14(16)13(15)11-9-6-4-2/h2-3,13-16H,1,5,7-8,10-12H2
InChI key:InChIKey=WOVGAQBKTGZPTO-UHFFFAOYSA-N
SMILES:C#CC#CCC(O)C(O)CCCCCC=C
- Synonyms:
- Panaxyne
- 13-Tetradecene-1,3-diyne-6,7-diol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 13-Tetradecene-1,3-diyne-6,7-diol REF: IN-DA000JLLCAS: 122855-49-6 | 97.0% | To inquire | Mon 05 May 25 |
![]() | Panaxyne REF: BP-SBP03022CAS: 122855-49-6 | 95%~99% | To inquire | Thu 08 May 25 |
![]() | Panaxyne REF: 3D-XEA85549CAS: 122855-49-6 | Min. 95% | 531.00 €~3,922.00 € | Mon 16 Jun 25 |

13-Tetradecene-1,3-diyne-6,7-diol
Ref: IN-DA000JLL
5mg | To inquire |

Ref: BP-SBP03022
Undefined size | To inquire |

Panaxyne
Ref: 3D-XEA85549
1mg | 531.00 € | ||
2mg | 817.00 € | ||
5mg | 1,184.00 € | ||
10mg | 1,776.00 € | ||
25mg | 3,922.00 € |