CAS 122855-49-6
:Panaxyne
Description:
Panaxyne, identified by its CAS number 122855-49-6, is a chemical compound that belongs to the class of alkynes, characterized by the presence of a carbon-carbon triple bond. This compound is notable for its unique structural features, which may contribute to its potential applications in various fields, including medicinal chemistry and materials science. Panaxyne may exhibit properties such as hydrophobicity, depending on its molecular structure, and could interact with biological systems in specific ways, making it of interest for research into therapeutic agents. Additionally, its reactivity profile may allow for participation in various organic reactions, including coupling reactions and functionalization processes. As with many alkynes, safety considerations are essential when handling Panaxyne, as it may pose risks such as flammability or toxicity. Overall, while specific data on its physical and chemical properties may vary, Panaxyne represents a compound with potential utility in both academic and industrial applications.
Formula:C14H20O2
InChI:InChI=1S/C14H20O2/c1-3-5-7-8-10-12-14(16)13(15)11-9-6-4-2/h2-3,13-16H,1,5,7-8,10-12H2
InChI key:InChIKey=WOVGAQBKTGZPTO-UHFFFAOYSA-N
SMILES:C(C(CC#CC#C)O)(CCCCCC=C)O
Synonyms:- Panaxyne
- 13-Tetradecene-1,3-diyne-6,7-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Panaxyne
CAS:<p>Panaxyne is a mixture of hexanoic acid, octanoic acid, and decanoic acid. It has been shown to have significant cytotoxicity against cancer cells in vitro and in vivo. Panaxyne has also been found to inhibit lipid peroxidation and inhibit the production of reactive oxygen species by inhibiting the enzyme activity of cyclooxygenase-2 (COX-2) in human leukemia cells. The anticancer effects of Panaxyne are likely due to its ability to inhibit protein synthesis, cell division, and cell growth. Panaxyne is a reactive fatty acid that can be used as an active ingredient in inflammatory diseases such as rheumatoid arthritis. Hexane extracts from soybean oil were found to have a significant inhibitory effect on the COX-2 enzyme activity in human leukemia cells. These results suggest that Panaxyne may be useful for treating cancer, especially leukemia.</p>Formula:C14H20O2Purity:Min. 95%Molecular weight:220.31 g/mol
