CymitQuimica logo

CAS 122855-66-7

:

1-(4,6-difluoro-1,3,5-triazinyl)-2-methylisoindole

Description:
1-(4,6-Difluoro-1,3,5-triazinyl)-2-methylisoindole, identified by its CAS number 122855-66-7, is a chemical compound that features a unique structure combining a triazine ring with an isoindole moiety. The presence of fluorine atoms in the triazine ring enhances its chemical stability and can influence its reactivity and interaction with biological systems. This compound is characterized by its potential applications in various fields, including agrochemicals and pharmaceuticals, due to its ability to act as a herbicide or a building block for more complex molecules. The isoindole part of the structure contributes to its aromatic properties, which can affect solubility and lipophilicity. Additionally, the specific arrangement of functional groups can lead to interesting electronic properties, making it a subject of interest in material science and medicinal chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, highlighting its potential utility in diverse applications.
Formula:C12H8F2N4
InChI:InChI=1/C12H8F2N4/c1-18-6-7-4-2-3-5-8(7)9(18)10-15-11(13)17-12(14)16-10/h2-6H,1H3
SMILES:Cn1cc2ccccc2c1c1nc(F)nc(F)n1
Synonyms:
  • 1-Dftmi
  • 1-(2,4-difluoro-1,3,5-triazin-1(2H)-yl)-2-methyl-2H-isoindole
  • 1-(4,6-difluoro-1,3,5-triazin-2-yl)-2-methyl-2H-isoindole
  • 1-(4,6-Difluoro-1,3,5-triazinyl)-2-methylisoindole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.