
CAS 122855-96-3
:4-(Hydroxymethyl)benzenesulfonic acid
Description:
4-(Hydroxymethyl)benzenesulfonic acid, with the CAS number 122855-96-3, is an aromatic sulfonic acid characterized by the presence of a hydroxymethyl group (-CH2OH) attached to a benzene ring that also bears a sulfonic acid group (-SO3H). This compound is typically a white to off-white solid and is soluble in water due to the polar nature of the sulfonic acid group. It exhibits acidic properties, making it useful in various chemical applications, including as a reagent in organic synthesis and as a potential intermediate in the production of dyes and pharmaceuticals. The presence of both the hydroxymethyl and sulfonic acid functionalities allows for diverse reactivity, including nucleophilic substitution and esterification. Additionally, it may serve as a pH indicator or a buffering agent in biochemical applications. Safety data should be consulted for handling, as with many sulfonic acids, it may pose health risks if ingested or if it comes into contact with skin.
Formula:C7H8O4S
InChI:InChI=1S/C7H8O4S/c8-5-6-1-3-7(4-2-6)12(9,10)11/h1-4,8H,5H2,(H,9,10,11)
InChI key:InChIKey=VVQVMHASNBSOOC-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC=C(CO)C=C1
Synonyms:- 4-(Hydroxymethyl)benzenesulfonic acid
- Benzenesulfonic acid, 4-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
