CAS 1228550-58-0

(3R)-2,3-Dihydro-5-(1-methylethyl)-3-benzofuranamine

Description:

(3R)-2,3-Dihydro-5-(1-methylethyl)-3-benzofuranamine is a chemical compound characterized by its unique structural features, which include a benzofuran moiety and an amine functional group. This compound exhibits chirality, with the (3R) designation indicating the specific three-dimensional arrangement of its atoms. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The benzofuran structure is known for its potential biological activity, often associated with various pharmacological effects. As an amine, this compound may participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on its molecular interactions and purity. Overall, (3R)-2,3-Dihydro-5-(1-methylethyl)-3-benzofuranamine represents a compound of interest in medicinal chemistry, potentially serving as a lead structure for drug development or as a tool in biochemical research.

Formula: C₁₁H₁₅NO

InChI: InChI=1S/C11H15NO/c1-7(2)8-3-4-11-9(5-8)10(12)6-13-11/h3-5,7,10H,6,12H2,1-2H3/t10-/m0/s1

InChI key: InChIKey=NNXHBPIAZMDRQC-JTQLQIEISA-N

SMILES: N[C@@H]1C=2C(=CC=C(C(C)C)C2)OC1

Synonyms:

• (3R)-2,3-Dihydro-5-(1-methylethyl)-3-benzofuranamine
• 3-Benzofuranamine, 2,3-dihydro-5-(1-methylethyl)-, (3R)-