CAS 1228551-78-7

4,5-Dichloro-3-methyl-1H-pyrazole-1-acetic acid

Description:

4,5-Dichloro-3-methyl-1H-pyrazole-1-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of two chlorine atoms at the 4 and 5 positions, along with a methyl group at the 3 position, contributes to its unique reactivity and properties. The acetic acid functional group at the 1 position enhances its solubility in polar solvents and may influence its biological activity. This compound is often studied for its potential applications in pharmaceuticals and agrochemicals due to its ability to interact with biological systems. Its molecular structure suggests that it may exhibit herbicidal or fungicidal properties, making it of interest in agricultural chemistry. Additionally, the presence of halogens can affect the compound's stability and reactivity, influencing its behavior in various chemical reactions. As with many pyrazole derivatives, it may also exhibit interesting pharmacological activities, warranting further investigation into its mechanisms of action and potential uses.

Formula: C₆H₆Cl₂N₂O₂

InChI: InChI=1S/C6H6Cl2N2O2/c1-3-5(7)6(8)10(9-3)2-4(11)12/h2H2,1H3,(H,11,12)

InChI key: InChIKey=TWZKQIAHXWYVGH-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C(Cl)=C(Cl)C(C)=N1

Synonyms:

• 4,5-Dichloro-3-methyl-1H-pyrazole-1-acetic acid
• 1H-Pyrazole-1-acetic acid, 4,5-dichloro-3-methyl-