CAS 1228551-79-8

2-[4-(Aminocarbonyl)phenoxy]-4-methyl-5-thiazolecarboxylic acid

Description:

2-[4-(Aminocarbonyl)phenoxy]-4-methyl-5-thiazolecarboxylic acid, with the CAS number 1228551-79-8, is a chemical compound characterized by its complex structure that includes both aromatic and heterocyclic components. This substance features a thiazole ring, which is a five-membered ring containing sulfur and nitrogen, contributing to its potential biological activity. The presence of an aminocarbonyl group indicates that it may participate in various chemical reactions, particularly those involving amide formation or nucleophilic attacks. The phenoxy group enhances its solubility in organic solvents and may influence its interaction with biological targets. Additionally, the carboxylic acid functional group suggests that it can act as a weak acid, potentially participating in acid-base reactions. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. Its specific applications and efficacy would depend on detailed studies of its biological activity and interactions.

Formula: C₁₂H₁₀N₂O₄S

InChI: InChI=1S/C12H10N2O4S/c1-6-9(11(16)17)19-12(14-6)18-8-4-2-7(3-5-8)10(13)15/h2-5H,1H3,(H2,13,15)(H,16,17)

InChI key: InChIKey=KJKNXCBZUNRALH-UHFFFAOYSA-N

SMILES: O(C=1SC(C(O)=O)=C(C)N1)C2=CC=C(C(N)=O)C=C2

Synonyms:

• 2-(4-Carbamoyl-phenoxy)-4-methyl-thiazole-5-carboxylic acid
• 2-(4-Carbamoylphenoxy)-4-methyl-1,3-thiazole-5-carboxylic acid
• 5-Thiazolecarboxylic acid, 2-[4-(aminocarbonyl)phenoxy]-4-methyl-
• 2-[4-(Aminocarbonyl)phenoxy]-4-methyl-5-thiazolecarboxylic acid