CAS 1228551-82-3

5-Chloro-2-(4-ethoxyphenoxy)-3-pyridinecarboxylic acid

Description:

5-Chloro-2-(4-ethoxyphenoxy)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and an ethoxy-substituted phenyl group. The presence of the chlorine atom at the 5-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its solubility and stability can vary depending on the pH and solvent conditions, which are important factors to consider in practical applications. The carboxylic acid group can participate in various chemical reactions, such as esterification and amidation, making it a versatile building block in organic synthesis. Additionally, the ethoxy group may influence the compound's lipophilicity and overall pharmacokinetic properties. As with many chemical substances, safety data and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₄H₁₂ClNO₄

InChI: InChI=1S/C14H12ClNO4/c1-2-19-10-3-5-11(6-4-10)20-13-12(14(17)18)7-9(15)8-16-13/h3-8H,2H2,1H3,(H,17,18)

InChI key: InChIKey=VJKFXCBYZIKRNM-UHFFFAOYSA-N

SMILES: O(C1=C(C(O)=O)C=C(Cl)C=N1)C2=CC=C(OCC)C=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 5-chloro-2-(4-ethoxyphenoxy)-
• 5-Chloro-2-(4-ethoxyphenoxy)-3-pyridinecarboxylic acid