CAS 1228552-42-8

2-(2-Chlorophenoxy)-5-methyl-4-thiazolecarboxylic acid

Description:

2-(2-Chlorophenoxy)-5-methyl-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring, a carboxylic acid functional group, and a chlorophenoxy moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group. The thiazole ring contributes to its biological activity, making it of interest in pharmaceutical research. The chlorophenoxy group may enhance its lipophilicity, influencing its interaction with biological membranes. Additionally, the presence of chlorine can affect the compound's electronic properties and reactivity. Overall, this compound may exhibit a range of biological activities, making it a candidate for further investigation in medicinal chemistry and agrochemical applications. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of chlorine and the potential for environmental impact.

Formula: C₁₁H₈ClNO₃S

InChI: InChI=1S/C11H8ClNO3S/c1-6-9(10(14)15)13-11(17-6)16-8-5-3-2-4-7(8)12/h2-5H,1H3,(H,14,15)

InChI key: InChIKey=MULYPOXYUIOYEM-UHFFFAOYSA-N

SMILES: O(C1=NC(C(O)=O)=C(C)S1)C2=C(Cl)C=CC=C2

Synonyms:

• 2-(2-Chlorophenoxy)-5-methyl-4-thiazolecarboxylic acid
• 4-Thiazolecarboxylic acid, 2-(2-chlorophenoxy)-5-methyl-