
CAS 1228552-88-2
:2-Bromo-1-(7-bromo-3-quinolinyl)ethanone
Description:
2-Bromo-1-(7-bromo-3-quinolinyl)ethanone is a chemical compound characterized by its unique structure, which includes a bromo substituent and a quinoline moiety. This compound features a bromine atom attached to both the ethanone and the quinoline ring, contributing to its reactivity and potential biological activity. The presence of the quinoline structure suggests possible applications in medicinal chemistry, as quinolines are known for their diverse pharmacological properties, including antimalarial and antibacterial activities. The ethanone functional group indicates that this compound may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, the bromine atoms can enhance the compound's lipophilicity, potentially influencing its bioavailability and interaction with biological targets. Overall, 2-Bromo-1-(7-bromo-3-quinolinyl)ethanone is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its properties and applications.
Formula:C11H7Br2NO
InChI:InChI=1S/C11H7Br2NO/c12-5-11(15)8-3-7-1-2-9(13)4-10(7)14-6-8/h1-4,6H,5H2
InChI key:InChIKey=IVLSVVSRBDNXTK-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C1=CC2=C(C=C(Br)C=C2)N=C1
Synonyms:- 2-Bromo-1-(7-bromo-3-quinolinyl)ethanone
- Ethanone, 2-bromo-1-(7-bromo-3-quinolinyl)-
- 2-Bromo-1-(7-bromoquinolin-3-yl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.