CAS 1228552-96-2: Ethyl 2-(1,3-benzodioxol-5-yloxy)-5-methyl-4-thiazolecarboxylate
Description:Ethyl 2-(1,3-benzodioxol-5-yloxy)-5-methyl-4-thiazolecarboxylate is a chemical compound characterized by its complex structure, which includes a thiazole ring and a benzodioxole moiety. This compound typically exhibits properties associated with both thiazole and ether functionalities, potentially influencing its reactivity and solubility. The presence of the ethyl ester group suggests it may have moderate polarity, making it soluble in organic solvents while being less soluble in water. The benzodioxole fragment is known for its potential biological activity, often associated with various pharmacological effects. Additionally, the thiazole ring can contribute to the compound's ability to participate in diverse chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, this compound may be of interest in medicinal chemistry and material science due to its unique structural features and potential applications in drug development or as a synthetic intermediate. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C14H13NO5S
InChI:InChI=1S/C14H13NO5S/c1-3-17-13(16)12-8(2)21-14(15-12)20-9-4-5-10-11(6-9)19-7-18-10/h4-6H,3,7H2,1-2H3
InChI key:InChIKey=JJUGBMGSDCZWTP-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1N=C(OC2=CC=C3OCOC3=C2)SC1C
- Synonyms:
- 4-Thiazolecarboxylic acid, 2-(1,3-benzodioxol-5-yloxy)-5-methyl-, ethyl ester
- Ethyl 2-(1,3-benzodioxol-5-yloxy)-5-methyl-4-thiazolecarboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | ethyl 2-(1,3-benzodioxol-5-yloxy)-5-methyl-1,3-thiazole-4-carboxylate REF: 10-F369930CAS: 1228552-96-2 | - - - | - - - | Discontinued product |
 | Ethyl 2-(1,3-benzodioxol-5-yloxy)-5-methyl-1,3-thiazole-4-carboxylate REF: 3D-FE123384CAS: 1228552-96-2 | Min. 95% | - - - | Discontinued product |
ethyl 2-(1,3-benzodioxol-5-yloxy)-5-methyl-1,3-thiazole-4-carboxylate
Ref: 10-F369930
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
Ethyl 2-(1,3-benzodioxol-5-yloxy)-5-methyl-1,3-thiazole-4-carboxylate
Ref: 3D-FE123384
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
