CymitQuimica logo

CAS 1228553-10-3

:

5-Chloro-N,N-dimethyl-1H-1,2,4-triazole-3-carboxamide

Description:
5-Chloro-N,N-dimethyl-1H-1,2,4-triazole-3-carboxamide is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a chloro substituent at the 5-position and a dimethylamino group at the 1-position, contributing to its unique chemical properties. The carboxamide functional group at the 3-position enhances its solubility in polar solvents and may influence its biological activity. This compound is often studied for its potential applications in agriculture, particularly as a fungicide or herbicide, due to its ability to inhibit specific biochemical pathways in target organisms. Its molecular structure allows for interactions with various biological targets, making it of interest in medicinal chemistry as well. Safety and handling precautions are essential when working with this compound, as with many chemicals, due to potential toxicity and environmental impact.
Formula:C5H7ClN4O
InChI:InChI=1S/C5H7ClN4O/c1-10(2)4(11)3-7-5(6)9-8-3/h1-2H3,(H,7,8,9)
InChI key:InChIKey=ZZKWOTPFBLRTOC-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1=NN=C(Cl)N1
Synonyms:
  • 5-Chloro-N,N-dimethyl-1H-1,2,4-triazole-3-carboxamide
  • 1H-1,2,4-Triazole-3-carboxamide, 5-chloro-N,N-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.