CymitQuimica logo

CAS 1228553-13-6

:

5,6,7,8-Tetrahydro-7,7-dimethyl-2-(4-morpholinyl)-5-quinazolinamine

Description:
5,6,7,8-Tetrahydro-7,7-dimethyl-2-(4-morpholinyl)-5-quinazolinamine is a chemical compound characterized by its complex structure, which includes a quinazoline core fused with a tetrahydro moiety and a morpholine substituent. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity due to its ability to interact with various biological targets. The presence of the morpholine ring suggests it may have solubility in polar solvents and could participate in hydrogen bonding, influencing its pharmacokinetic properties. The dimethyl groups contribute to its steric bulk, which may affect its binding affinity and selectivity for specific receptors or enzymes. As a quinazolinamine derivative, it may be of interest in medicinal chemistry, particularly for its potential applications in treating various conditions, including cancer or neurological disorders. However, detailed studies on its biological activity, toxicity, and pharmacological profile would be necessary to fully understand its characteristics and potential uses.
Formula:C14H22N4O
InChI:InChI=1S/C14H22N4O/c1-14(2)7-11(15)10-9-16-13(17-12(10)8-14)18-3-5-19-6-4-18/h9,11H,3-8,15H2,1-2H3
InChI key:InChIKey=GCMJQJPFPCEJSY-UHFFFAOYSA-N
SMILES:NC1C=2C(=NC(=NC2)N3CCOCC3)CC(C)(C)C1
Synonyms:
  • 5-Quinazolinamine, 5,6,7,8-tetrahydro-7,7-dimethyl-2-(4-morpholinyl)-
  • 5,6,7,8-Tetrahydro-7,7-dimethyl-2-(4-morpholinyl)-5-quinazolinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.