
CAS 1228556-63-5
:(1S)-2,3-Dihydro-6-methyl-1H-inden-1-amine
Description:
(1S)-2,3-Dihydro-6-methyl-1H-inden-1-amine is an organic compound characterized by its bicyclic structure, which includes a six-membered aromatic ring fused to a five-membered ring. The presence of an amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The specific stereochemistry denoted by (1S) suggests that the compound has a defined spatial arrangement, which can affect its biological activity and interactions with other molecules. The methyl group at the 6-position contributes to the compound's hydrophobic characteristics, potentially impacting its pharmacokinetics if it is used in medicinal chemistry. This compound may exhibit properties relevant to various fields, including pharmaceuticals, where it could serve as a lead compound for drug development or as a building block in synthetic organic chemistry. Its CAS number, 1228556-63-5, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in scientific literature and databases.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6,10H,4-5,11H2,1H3/t10-/m0/s1
InChI key:InChIKey=FMQGLSSKBZCURE-JTQLQIEISA-N
SMILES:N[C@@H]1C=2C(=CC=C(C)C2)CC1
Synonyms:- (1S)-2,3-Dihydro-6-methyl-1H-inden-1-amine
- 1H-Inden-1-amine, 2,3-dihydro-6-methyl-, (1S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.