CAS 1228557-23-0

(αS)-5-Chloro-2-fluoro-α-methylbenzenemethanamine

Description:

(αS)-5-Chloro-2-fluoro-α-methylbenzenemethanamine is a chemical compound characterized by its specific stereochemistry and functional groups. It features a benzene ring substituted with a chlorine atom at the 5-position and a fluorine atom at the 2-position, along with an α-methyl group and an amine functional group. The presence of these substituents influences its chemical reactivity, polarity, and potential biological activity. The compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its solubility in various solvents. Additionally, the specific arrangement of the substituents contributes to its stereochemical properties, which may play a significant role in its interaction with biological targets. As a compound with potential pharmaceutical applications, understanding its characteristics is crucial for predicting its behavior in biological systems and its potential therapeutic effects.

Formula: C₈H₉ClFN

InChI: InChI=1S/C8H9ClFN/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5H,11H2,1H3/t5-/m0/s1

InChI key: InChIKey=ZZXFFISCWUZQPY-YFKPBYRVSA-N

SMILES: [C@@H](C)(N)C1=C(F)C=CC(Cl)=C1

Synonyms:

• Benzenemethanamine, 5-chloro-2-fluoro-α-methyl-, (αS)-
• (1S)-1-(5-Chloro-2-fluorophenyl)ethan-1-amine
• (αS)-5-Chloro-2-fluoro-α-methylbenzenemethanamine