CAS 122856-01-3
:N-succinimidyl 3-(trimethylstannyl)benzoate
Description:
N-succinimidyl 3-(trimethylstannyl)benzoate is a chemical compound that belongs to the class of succinimidyl esters, which are commonly used as reactive intermediates in bioconjugation and labeling applications. This compound features a benzoate moiety substituted with a trimethylstannyl group, which enhances its reactivity and facilitates the attachment of biomolecules, such as proteins or nucleic acids. The presence of the succinimidyl group allows for the formation of stable amide bonds with primary amines, making it particularly useful in the development of bioconjugates. The trimethylstannyl group also provides unique properties, such as increased lipophilicity and potential for further functionalization. In terms of stability, N-succinimidyl 3-(trimethylstannyl)benzoate is generally stable under dry conditions but should be handled with care due to the toxicity associated with organotin compounds. Overall, this compound is valuable in chemical biology and medicinal chemistry for its ability to facilitate the conjugation of various biomolecules.
Formula:C14H17NO4Sn
InChI:InChI=1/C11H8NO4.3CH3.Sn/c13-9-6-7-10(14)12(9)16-11(15)8-4-2-1-3-5-8;;;;/h1-2,4-5H,6-7H2;3*1H3;/rC14H17NO4Sn/c1-20(2,3)11-6-4-5-10(9-11)14(18)19-15-12(16)7-8-13(15)17/h4-6,9H,7-8H2,1-3H3
SMILES:C[Sn](C)(C)c1cccc(c1)C(=O)ON1C(=O)CCC1=O
Synonyms:- m-Meate
- 2,5-Pyrrolidinedione, 1-((3-(trimethylstannyl)benzoyl)oxy)-
- 1-{[3-(Trimethylstannanyl)Benzoyl]Oxy}Pyrrolidine-2,5-Dione
- N-Succinimidyl 3-(trimethylstannyl)benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3-(trimethylstannyl)-, 2,5-dioxo-1-pyrrolidinyl ester
CAS:Formula:C14H17NO4SnPurity:95%Color and Shape:LiquidMolecular weight:381.9901N-succinimidyl 3-(trimethylstannyl)benzoate
CAS:<p>N-succinimidyl 3-(trimethylstannyl)benzoate</p>Purity:98%Molecular weight:382g/molN-Succinimidyl 3-Trimethylstannyl-benzoate
CAS:Controlled Product<p>Applications A compound used potentially for the radioiodination of monoclonal antibodies. Used in Antibody labelling.<br>References Garg, P.K., et al.: Appl. Radiat. Isot., 40, 6, 485 (1989), Garg, P.K., et al.: Nucl. Med. Biol., 20, 4, 379 (1993),<br></p>Formula:C14H17NO4SnColor and Shape:NeatMolecular weight:382.00N-SUCCINIMIDYL 3-(TRIMETHYLSTANNYL)BENZOATE
CAS:Formula:C14H17NO4SnPurity:98%Molecular weight:382.003




