CAS 1228561-87-2

(2R)-2-(3-Methylphenyl)piperidine

Description:

(2R)-2-(3-Methylphenyl)piperidine, with the CAS number 1228561-87-2, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a 3-methylphenyl group attached to the second carbon of the piperidine ring, indicating a specific stereochemistry at the second carbon, denoted by the (2R) configuration. This stereochemistry can influence the compound's biological activity and interactions with receptors. Typically, compounds of this class may exhibit properties such as being lipophilic due to the aromatic ring, which can enhance their ability to cross biological membranes. The presence of the nitrogen atom in the piperidine ring often contributes to basicity, allowing for potential interactions with acidic sites in biological systems. Such compounds may be of interest in medicinal chemistry for their potential pharmacological effects, including analgesic or psychoactive properties, although specific biological activities would depend on further empirical studies.

Formula: C₁₂H₁₇N

InChI: InChI=1S/C12H17N/c1-10-5-4-6-11(9-10)12-7-2-3-8-13-12/h4-6,9,12-13H,2-3,7-8H2,1H3/t12-/m1/s1

InChI key: InChIKey=YKFXSWPGGIAPSM-GFCCVEGCSA-N

SMILES: CC=1C=C(C=CC1)[C@H]2CCCCN2

Synonyms:

• Piperidine, 2-(3-methylphenyl)-, (2R)-
• (2r)-2-(3-Methylphenyl)piperidine
• (2R)-2-(3-Methylphenyl)piperidine