
CAS 1228565-85-2
:(4R)-3,4-Dihydro-6-(trifluoromethyl)-2H-1-benzopyran-4-amine
Description:
(4R)-3,4-Dihydro-6-(trifluoromethyl)-2H-1-benzopyran-4-amine is a chemical compound characterized by its unique structural features, including a benzopyran core and a trifluoromethyl group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it a subject of interest in medicinal chemistry. The compound exhibits chirality, with the (4R) designation indicating the specific spatial arrangement of atoms around the chiral center, which can significantly affect its pharmacological properties. Its molecular structure suggests potential interactions with biological targets, possibly influencing pathways related to neurotransmission or other physiological processes. The compound's CAS number, 1228565-85-2, allows for precise identification and retrieval of information in chemical databases. Overall, this substance may have applications in drug development or as a research tool in studying specific biochemical mechanisms, although further investigation would be necessary to elucidate its full range of properties and potential uses.
Formula:C10H10F3NO
InChI:InChI=1S/C10H10F3NO/c11-10(12,13)6-1-2-9-7(5-6)8(14)3-4-15-9/h1-2,5,8H,3-4,14H2/t8-/m1/s1
InChI key:InChIKey=UPEDVFHMBQZINU-MRVPVSSYSA-N
SMILES:N[C@H]1C=2C(=CC=C(C(F)(F)F)C2)OCC1
Synonyms:- 2H-1-Benzopyran-4-amine, 3,4-dihydro-6-(trifluoromethyl)-, (4R)-
- (4R)-3,4-Dihydro-6-(trifluoromethyl)-2H-1-benzopyran-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.