
CAS 1228565-96-5
:(1S)-2,3-Dihydro-4-methoxy-1H-inden-1-amine
Description:
(1S)-2,3-Dihydro-4-methoxy-1H-inden-1-amine is a chemical compound characterized by its unique bicyclic structure, which includes an indene core with a methoxy group and an amine functional group. The presence of the methoxy group contributes to its potential for various chemical reactivity and interactions, while the amine group can participate in hydrogen bonding and act as a nucleophile. This compound is chiral, with the (1S) designation indicating the specific stereochemistry at the chiral center. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's properties, such as solubility, melting point, and reactivity, can vary based on its molecular structure and the presence of substituents. Its CAS number, 1228565-96-5, allows for precise identification in chemical databases and literature. Overall, (1S)-2,3-Dihydro-4-methoxy-1H-inden-1-amine represents a class of compounds that may have applications in drug development and other chemical research fields.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c1-12-10-4-2-3-7-8(10)5-6-9(7)11/h2-4,9H,5-6,11H2,1H3/t9-/m0/s1
InChI key:InChIKey=JMXMRMSUOHVHOF-VIFPVBQESA-N
SMILES:O(C)C1=C2C([C@@H](N)CC2)=CC=C1
Synonyms:- (1S)-2,3-Dihydro-4-methoxy-1H-inden-1-amine
- 1H-Inden-1-amine, 2,3-dihydro-4-methoxy-, (1S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.