
CAS 1228566-53-7
:2-[(1R)-1-Aminoethyl]-1,4-benzenediol
Description:
2-[(1R)-1-Aminoethyl]-1,4-benzenediol, also known as a derivative of catecholamine, is characterized by its structural features that include an aminoethyl side chain and two hydroxyl groups on a benzene ring. This compound exhibits properties typical of phenolic compounds, such as potential antioxidant activity due to the presence of hydroxyl groups, which can donate hydrogen atoms to free radicals. The amino group contributes to its basicity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The stereochemistry indicated by the (1R) configuration suggests specific spatial arrangements that may influence its biological activity and interaction with receptors. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting neurotransmitter systems or in studies related to cardiovascular health. Its unique combination of functional groups allows for diverse reactivity and potential applications in medicinal chemistry. However, detailed studies on its pharmacokinetics and toxicity would be essential for understanding its safety and efficacy in biological systems.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-5(9)7-4-6(10)2-3-8(7)11/h2-5,10-11H,9H2,1H3/t5-/m1/s1
InChI key:InChIKey=CIMLGYQRAUWPCM-RXMQYKEDSA-N
SMILES:[C@H](C)(N)C1=C(O)C=CC(O)=C1
Synonyms:- 1,4-Benzenediol, 2-[(1R)-1-aminoethyl]-
- 2-[(1R)-1-Aminoethyl]-1,4-benzenediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.