CAS 1228566-59-3

(αR)-4-(Diethylamino)-α-methylbenzenemethanamine

Description:

(αR)-4-(Diethylamino)-α-methylbenzenemethanamine, identified by its CAS number 1228566-59-3, is a chemical compound characterized by its amine functional group and a substituted aromatic ring. This substance features a diethylamino group, which enhances its basicity and potential for forming hydrogen bonds, making it relevant in various chemical and pharmaceutical applications. The presence of the α-methyl group contributes to its steric properties, influencing its interaction with biological targets. Typically, compounds of this nature may exhibit properties such as solubility in organic solvents, moderate to high boiling points, and potential for pharmacological activity, particularly in the central nervous system. The stereochemistry indicated by the (αR) designation suggests specific spatial arrangements that can significantly affect the compound's biological activity and receptor interactions. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and related fields.

Formula: C₁₂H₂₀N₂

InChI: InChI=1S/C12H20N2/c1-4-14(5-2)12-8-6-11(7-9-12)10(3)13/h6-10H,4-5,13H2,1-3H3/t10-/m1/s1

InChI key: InChIKey=AOFFRNRKONGMMO-SNVBAGLBSA-N

SMILES: N(CC)(CC)C1=CC=C([C@@H](C)N)C=C1

Synonyms:

• (αR)-4-(Diethylamino)-α-methylbenzenemethanamine
• Benzenemethanamine, 4-(diethylamino)-α-methyl-, (αR)-