CAS 1228568-37-3

(αS)-α-Amino-2-pyridineacetic acid

Description:

(αS)-α-Amino-2-pyridineacetic acid, with the CAS number 1228568-37-3, is an amino acid derivative characterized by the presence of a pyridine ring. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, which contribute to its potential as a building block in peptide synthesis and pharmaceutical applications. The stereochemistry indicated by the (αS) designation suggests that it has a specific spatial arrangement of its atoms, which can influence its biological activity and interactions. The pyridine moiety introduces unique properties, such as the ability to participate in hydrogen bonding and coordination with metal ions, enhancing its reactivity and functionality. This compound may exhibit solubility in polar solvents, and its behavior in biological systems could be influenced by its pH-dependent ionization. Overall, (αS)-α-Amino-2-pyridineacetic acid is of interest in medicinal chemistry and biochemistry due to its structural features and potential applications.

Formula: C₇H₈N₂O₂

InChI: InChI=1S/C7H8N2O2/c8-6(7(10)11)5-3-1-2-4-9-5/h1-4,6H,8H2,(H,10,11)/t6-/m0/s1

InChI key: InChIKey=JTOBAFRWEGCWGI-LURJTMIESA-N

SMILES: [C@H](C(O)=O)(N)C1=CC=CC=N1

Synonyms:

• (αS)-α-Amino-2-pyridineacetic acid
• (s)-Amino-pyridin-2-yl-acetic acid
• 2-Pyridineacetic acid, α-amino-, (αS)-