CAS 1228569-83-2

(2S)-2-(2,5-Dichlorophenyl)pyrrolidine

Description:

(2S)-2-(2,5-Dichlorophenyl)pyrrolidine is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated nitrogen-containing heterocycle. The presence of the 2,5-dichlorophenyl group indicates that two chlorine atoms are substituted on a phenyl ring at the 2 and 5 positions, contributing to the compound's unique properties. This compound is typically studied for its potential biological activity, particularly in the context of medicinal chemistry, where modifications to the pyrrolidine structure can influence pharmacological effects. The stereochemistry indicated by the (2S) designation suggests that the compound has a specific three-dimensional arrangement, which can significantly affect its interaction with biological targets, such as receptors or enzymes. Additionally, the dichlorophenyl substituent may enhance lipophilicity, potentially influencing the compound's solubility and permeability. Overall, (2S)-2-(2,5-Dichlorophenyl)pyrrolidine is of interest in research for its potential applications in drug development and its role in understanding structure-activity relationships in pharmacology.

Formula: C₁₀H₁₁Cl₂N

InChI: InChI=1S/C10H11Cl2N/c11-7-3-4-9(12)8(6-7)10-2-1-5-13-10/h3-4,6,10,13H,1-2,5H2/t10-/m0/s1

InChI key: InChIKey=QPWHFAUOXMVIQL-JTQLQIEISA-N

SMILES: ClC1=C(C=C(Cl)C=C1)[C@@H]2CCCN2

Synonyms:

• (2S)-2-(2,5-Dichlorophenyl)pyrrolidine
• Pyrrolidine, 2-(2,5-dichlorophenyl)-, (2S)-