CAS 1228572-19-7
:3-(1-Methyl-1H-indol-5-yl)-2-propenoic acid
Description:
3-(1-Methyl-1H-indol-5-yl)-2-propenoic acid, also known by its CAS number 1228572-19-7, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a propenoic acid moiety, indicating the presence of a double bond and a carboxylic acid functional group. The indole ring contributes to its potential biological activity, as indole derivatives are often associated with various pharmacological properties. The presence of the methyl group at the 1-position of the indole enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The compound may exhibit properties such as anti-inflammatory, antioxidant, or anticancer activities, making it of interest in medicinal chemistry. Its synthesis typically involves organic reactions that form the propenoic acid linkage while preserving the integrity of the indole structure. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c1-13-7-6-10-8-9(2-4-11(10)13)3-5-12(14)15/h2-8H,1H3,(H,14,15)
InChI key:InChIKey=IZZVPUQKWOCNSS-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C=CC(O)=O)=CC2)C=C1
Synonyms:- 2-Propenoic acid, 3-(1-methyl-1H-indol-5-yl)-
- 3-(1-Methyl-1H-indol-5-yl)-2-propenoic acid
- (2E)-3-(1-METHYL-1H-INDOL-5-YL)ACRYLIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.