CymitQuimica logo

CAS 1228572-21-1

:

1-(2-Ethyl-4-hydroxy-1,1-dioxido-2H-1,2-benzothiazin-3-yl)-3-(4-methoxyphenyl)-2-propen-1-one

Description:
1-(2-Ethyl-4-hydroxy-1,1-dioxido-2H-1,2-benzothiazin-3-yl)-3-(4-methoxyphenyl)-2-propen-1-one, identified by CAS number 1228572-21-1, is a synthetic organic compound characterized by its complex structure, which includes a benzothiazine moiety and a propenone group. This compound features a hydroxyl group and a methoxyphenyl substituent, contributing to its potential biological activity. The presence of the dioxido group suggests that it may exhibit unique reactivity or stability under certain conditions. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical interactions. The compound's solubility, stability, and reactivity would depend on its specific molecular interactions and the environment in which it is placed. Further studies would be necessary to elucidate its pharmacological properties and potential therapeutic uses.
Formula:C20H19NO5S
InChI:InChI=1S/C20H19NO5S/c1-3-21-19(17(22)13-10-14-8-11-15(26-2)12-9-14)20(23)16-6-4-5-7-18(16)27(21,24)25/h4-13,23H,3H2,1-2H3
InChI key:InChIKey=WQVSVAPJONKEOO-UHFFFAOYSA-N
SMILES:C(C=CC1=CC=C(OC)C=C1)(=O)C=2N(CC)S(=O)(=O)C=3C(C2O)=CC=CC3
Synonyms:
  • 1-(2-Ethyl-4-hydroxy-1,1-dioxido-2H-1,2-benzothiazin-3-yl)-3-(4-methoxyphenyl)-2-propen-1-one
  • 2-Propen-1-one, 1-(2-ethyl-4-hydroxy-1,1-dioxido-2H-1,2-benzothiazin-3-yl)-3-(4-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.