CAS 1228600-47-2

4-Chloro-8-quinazolinamine

Description:

4-Chloro-8-quinazolinamine is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the 4-position and an amino group at the 8-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The chlorine substituent can influence the compound's lipophilicity and overall pharmacokinetic properties. Additionally, 4-Chloro-8-quinazolinamine may serve as a scaffold for further chemical modifications, allowing for the exploration of structure-activity relationships in drug design. As with many quinazoline derivatives, it may exhibit a range of biological activities, including anti-cancer and anti-inflammatory properties, making it a compound of interest in ongoing research.

Formula: C₈H₆ClN₃

InChI: InChI=1S/C8H6ClN3/c9-8-5-2-1-3-6(10)7(5)11-4-12-8/h1-4H,10H2

InChI key: InChIKey=UBKBXNBJACYSSY-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C(N)=CC=C2)N=CN1

Synonyms:

• 8-Quinazolinamine, 4-chloro-
• 4-Chloro-8-quinazolinamine