CAS 1228600-55-2

3-Pentanol, 2-amino-, hydrochloride (1:1)

Description:

3-Pentanol, 2-amino-, hydrochloride (1:1) is a chemical compound characterized by its amine and alcohol functional groups. As a hydrochloride salt, it is typically a white crystalline solid that is soluble in water, which enhances its utility in various applications, particularly in pharmaceuticals. The presence of the amino group suggests potential basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The alcohol group contributes to its ability to form hydrogen bonds, influencing its solubility and interaction with biological systems. This compound may exhibit properties typical of both alcohols and amines, including potential use as a building block in organic synthesis or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, 3-Pentanol, 2-amino-, hydrochloride is of interest in both research and industrial contexts.

Formula: C₅H₁₃NO·ClH

InChI: InChI=1S/C5H13NO.ClH/c1-3-5(7)4(2)6;/h4-5,7H,3,6H2,1-2H3;1H

InChI key: InChIKey=GVYLZPGAVBXTTL-UHFFFAOYSA-N

SMILES: C(C(C)N)(CC)O.Cl

Synonyms:

• 3-Pentanol, 2-amino-, hydrochloride (1:1)