CymitQuimica logo

CAS 1228665-48-2

:

6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-(2-propen-1-yl)pyridine

Description:
The chemical substance known as 6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-(2-propen-1-yl)pyridine, with the CAS number 1228665-48-2, is a complex organic compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, contributing to its potential biological activity. The presence of a fluorine atom and a propenyl group suggests that it may exhibit interesting reactivity and possibly serve as a precursor in synthetic chemistry. The dimethylsilyl group indicates that the compound may possess enhanced stability and solubility properties, which are often advantageous in medicinal chemistry. Additionally, the pyrrolidinyl moiety may impart specific pharmacological properties, making it a candidate for further investigation in drug development. Overall, this compound's intricate structure and functional groups suggest potential applications in various fields, including pharmaceuticals and materials science. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C19H31FN2OSi
InChI:InChI=1S/C19H31FN2OSi/c1-7-8-16-9-10-17(21-18(16)20)22-12-11-15(13-22)14-23-24(5,6)19(2,3)4/h7,9-10,15H,1,8,11-14H2,2-6H3
InChI key:InChIKey=GHHPFVLQPIAZFW-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C1CN(CC1)C=2N=C(F)C(CC=C)=CC2
Synonyms:
  • Pyridine, 6-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-(2-propen-1-yl)-
  • 6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-(2-propen-1-yl)pyridine
  • 3-Allyl-6-(3-((tert-butyldimethylsilyloxy)methyl)-pyrrolidin-1-yl)-2-fluoropyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.