CymitQuimica logo

CAS 1228665-63-1

:

5-Fluoro-6-iodo-1H-pyrrolo[2,3-b]pyridine

Description:
5-Fluoro-6-iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of fluorine and iodine substituents enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound typically exhibits moderate to high lipophilicity due to the halogen substituents, which can influence its bioavailability and interaction with biological targets. The molecular structure allows for various functionalization possibilities, making it a valuable intermediate in organic synthesis. Additionally, the compound may exhibit interesting electronic properties due to the presence of the electron-withdrawing halogens, which can affect its behavior in chemical reactions and interactions with other molecules. Overall, 5-Fluoro-6-iodo-1H-pyrrolo[2,3-b]pyridine is of interest for its potential applications in drug discovery and development, particularly in targeting specific biological pathways.
Formula:C7H4FIN2
InChI:InChI=1S/C7H4FIN2/c8-5-3-4-1-2-10-7(4)11-6(5)9/h1-3H,(H,10,11)
InChI key:InChIKey=AVANIMKSNTZKIZ-UHFFFAOYSA-N
SMILES:FC=1C=C2C(=NC1I)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 5-fluoro-6-iodo-
  • 5-Fluoro-6-iodo-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.