CymitQuimica logo

CAS 1228665-68-6

:

6-[(3-Iodo-2-pyridinyl)oxy]furo[3,2-b]pyridine

Description:
6-[(3-Iodo-2-pyridinyl)oxy]furo[3,2-b]pyridine is a chemical compound characterized by its complex heterocyclic structure, which includes a furo[3,2-b]pyridine core and a 3-iodo-2-pyridinyl ether substituent. This compound features a fused bicyclic system that contributes to its unique chemical properties, including potential biological activity. The presence of the iodine atom may enhance its reactivity and influence its interactions with biological targets, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. Additionally, its potential applications may include roles in drug development or as a research tool in studying specific biochemical pathways. As with many heterocycles, the electronic properties imparted by the nitrogen and oxygen atoms in the structure can affect its behavior in various chemical reactions and interactions. Safety and handling precautions should be observed due to the presence of iodine and the potential for biological activity.
Formula:C12H7IN2O2
InChI:InChI=1S/C12H7IN2O2/c13-9-2-1-4-14-12(9)17-8-6-11-10(15-7-8)3-5-16-11/h1-7H
InChI key:InChIKey=NWAMJLNYGZWHOU-UHFFFAOYSA-N
SMILES:O(C=1C=C2C(=NC1)C=CO2)C3=C(I)C=CC=N3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.